CAS 1480459-88-8 appears in our catalog under these names: 3,3,3-Trifluoro-1-(5-fluoro-1H-indol-3-yl)propan-1-one, 95%, 3,3,3-Trifluoro-1-(5-fluoro-1H-indol-3-yl)propan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3,3,3-trifluoro-1-(5-fluoro-1H-indol-3-yl)propan-1-one (CAS 1480459-88-8) is a chemical compound with the molecular formula C11H7F4NO and a molecular weight of 245.17 g/mol. IUPAC name: 3,3,3-trifluoro-1-(5-fluoro-1H-indol-3-yl)propan-1-one. InChIKey: NRCMEPMUFFWVAQ-UHFFFAOYSA-N.
| Molecular formula | C11H7F4NO |
|---|---|
| Molecular weight | 245.17 g/mol |
| IUPAC name | 3,3,3-trifluoro-1-(5-fluoro-1H-indol-3-yl)propan-1-one |
| InChIKey | NRCMEPMUFFWVAQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CN2)C(=O)CC(F)(F)F |
Computed by PubChem (NCBI)