CAS 1481-99-8 appears in our catalog under these names: Spiro[5.5]undecane-2,4-dione, 95%, Spiro(5.5)undecane-2,4-dione. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 250mg, 5g, 1g, 2,5g.
Spiro[5.5]undecane-2,4-dione (CAS 1481-99-8) is a chemical compound with the molecular formula C11H16O2 and a molecular weight of 180.24 g/mol. IUPAC name: spiro[5.5]undecane-2,4-dione. InChIKey: LKFBIHAJCFDIIN-UHFFFAOYSA-N.
| Molecular formula | C11H16O2 |
|---|---|
| Molecular weight | 180.24 g/mol |
| IUPAC name | spiro[5.5]undecane-2,4-dione |
| InChIKey | LKFBIHAJCFDIIN-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CC(=O)CC(=O)C2 |
Computed by PubChem (NCBI)