Products 14816-20-7

CAS 14816-20-7 is the registry number for Chlorphoxim. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 2,5g, 100mg.

Structural formula: {0} (CAS {1})

2-chloro-N-diethoxyphosphinothioyloxybenzenecarboximidoyl cyanide (CAS 14816-20-7) is a chemical compound with the molecular formula C12H14ClN2O3PS and a molecular weight of 332.74 g/mol. IUPAC name: 2-chloro-N-diethoxyphosphinothioyloxybenzenecarboximidoyl cyanide. InChIKey: GQKRUMZWUHSLJF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14ClN2O3PS
Molecular weight332.74 g/mol
IUPAC name2-chloro-N-diethoxyphosphinothioyloxybenzenecarboximidoyl cyanide
InChIKeyGQKRUMZWUHSLJF-UHFFFAOYSA-N
SMILESCCOP(=S)(OCC)ON=C(C#N)C1=CC=CC=C1Cl

Computed by PubChem (NCBI)