CAS 1481616-19-6 appears in our catalog under these names: (5-Bromo-2-(methylthio)pyrimidin-4-yl)methyl methanesulfonate, 95%, (5-Bromo-2-(methylthio)pyrimidin-4-yl)methyl methanesulfonate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 250mg.
(5-bromo-2-methylsulfanylpyrimidin-4-yl)methyl methanesulfonate (CAS 1481616-19-6) is a chemical compound with the molecular formula C7H9BrN2O3S2 and a molecular weight of 313.2 g/mol. IUPAC name: (5-bromo-2-methylsulfanylpyrimidin-4-yl)methyl methanesulfonate. InChIKey: YBYSZADVFSQWLH-UHFFFAOYSA-N.
| Molecular formula | C7H9BrN2O3S2 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | (5-bromo-2-methylsulfanylpyrimidin-4-yl)methyl methanesulfonate |
| InChIKey | YBYSZADVFSQWLH-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C(C(=N1)COS(=O)(=O)C)Br |
Computed by PubChem (NCBI)