CAS 1482000-91-8 appears in our catalog under these names: 3-(3-Fluoro-4-methoxyphenyl)-1,2,4-thiadiazol-5-amine, 95%, 3-(3-Fluoro-4-methoxyphenyl)-1,2,4-thiadiazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(3-fluoro-4-methoxyphenyl)-1,2,4-thiadiazol-5-amine (CAS 1482000-91-8) is a chemical compound with the molecular formula C9H8FN3OS and a molecular weight of 225.25 g/mol. IUPAC name: 3-(3-fluoro-4-methoxyphenyl)-1,2,4-thiadiazol-5-amine. InChIKey: CPXCKQPMQSOIKQ-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3OS |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 3-(3-fluoro-4-methoxyphenyl)-1,2,4-thiadiazol-5-amine |
| InChIKey | CPXCKQPMQSOIKQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NSC(=N2)N)F |
Computed by PubChem (NCBI)