CAS 1482078-60-3 is the registry number for CRBN ligand-227. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-amino-N-(2,6-dioxopiperidin-3-yl)-2-fluorobenzamide (CAS 1482078-60-3) is a chemical compound with the molecular formula C12H12FN3O3 and a molecular weight of 265.24 g/mol. IUPAC name: 4-amino-N-(2,6-dioxopiperidin-3-yl)-2-fluorobenzamide. InChIKey: PDXLABFIWQGDLW-UHFFFAOYSA-N.
| Molecular formula | C12H12FN3O3 |
|---|---|
| Molecular weight | 265.24 g/mol |
| IUPAC name | 4-amino-N-(2,6-dioxopiperidin-3-yl)-2-fluorobenzamide |
| InChIKey | PDXLABFIWQGDLW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1NC(=O)C2=C(C=C(C=C2)N)F |
Computed by PubChem (NCBI)