Products 1482373-64-7
CAS 1482373-64-7 is the registry number for 2-(2,5-Dimethyl-1H-pyrrol-1-yl)-5-fluoropyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2,5-dimethylpyrrol-1-yl)-5-fluoropyridine (CAS 1482373-64-7) is a chemical compound with the molecular formula C11H11FN2 and a molecular weight of 190.22 g/mol. IUPAC name: 2-(2,5-dimethylpyrrol-1-yl)-5-fluoropyridine. InChIKey: ITXUHWIAELZFAO-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2 |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 2-(2,5-dimethylpyrrol-1-yl)-5-fluoropyridine |
| InChIKey | ITXUHWIAELZFAO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=NC=C(C=C2)F)C |
Computed by PubChem (NCBI)