CAS 148259-35-2 appears in our catalog under these names: tert-Butyl(dibromomethyl)dimethylsilane, 95%, tert-Butyl(dibromomethyl)dimethylsilane, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 10g.
Tert-butyl-(dibromomethyl)-dimethylsilane (CAS 148259-35-2) is a chemical compound with the molecular formula C7H16Br2Si and a molecular weight of 288.09 g/mol. IUPAC name: tert-butyl-(dibromomethyl)-dimethylsilane. InChIKey: XINIZQRUNWPXNM-UHFFFAOYSA-N.
| Molecular formula | C7H16Br2Si |
|---|---|
| Molecular weight | 288.09 g/mol |
| IUPAC name | tert-butyl-(dibromomethyl)-dimethylsilane |
| InChIKey | XINIZQRUNWPXNM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)C(Br)Br |
Computed by PubChem (NCBI)