CAS 1482794-07-9 appears in our catalog under these names: 7-Chloro-2,3-dihydrobenzofuran-3-ol, 97%, 7-Chloro-2,3-dihydrobenzofuran-3-ol, 97%, 97%, 7-CHLORO-2,3-DIHYDRO-1-BENZOFURAN-3-OL, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg.
7-chloro-2,3-dihydro-1-benzofuran-3-ol (CAS 1482794-07-9) is a chemical compound with the molecular formula C8H7ClO2 and a molecular weight of 170.59 g/mol. IUPAC name: 7-chloro-2,3-dihydro-1-benzofuran-3-ol. InChIKey: GRFBRLOHRFCDOC-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO2 |
|---|---|
| Molecular weight | 170.59 g/mol |
| IUPAC name | 7-chloro-2,3-dihydro-1-benzofuran-3-ol |
| InChIKey | GRFBRLOHRFCDOC-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C(=CC=C2)Cl)O |
Computed by PubChem (NCBI)