Products 148333-42-0
CAS 148333-42-0 is the registry number for Ac-Leu-Leu-Norleucinol, 98.05%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 5 mg.
(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid (CAS 148333-42-0) is a chemical compound with the molecular formula C20H37N3O5 and a molecular weight of 399.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid. InChIKey: ALMQDMPRSWZSDO-ULQDDVLXSA-N.
| Molecular formula | C20H37N3O5 |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
| InChIKey | ALMQDMPRSWZSDO-ULQDDVLXSA-N |
| SMILES | CCCC[C@@H](C(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)C |
Computed by PubChem (NCBI)