CAS 1483990-11-9 appears in our catalog under these names: (5-(Methoxymethyl)isoxazol-3-yl)methanesulfonyl chloride, 98%, (5-(Methoxymethyl)-1,2-oxazol-3-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
[5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride (CAS 1483990-11-9) is a chemical compound with the molecular formula C6H8ClNO4S and a molecular weight of 225.65 g/mol. IUPAC name: [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride. InChIKey: KDPKJQAMRYMTRW-UHFFFAOYSA-N.
| Molecular formula | C6H8ClNO4S |
|---|---|
| Molecular weight | 225.65 g/mol |
| IUPAC name | [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride |
| InChIKey | KDPKJQAMRYMTRW-UHFFFAOYSA-N |
| SMILES | COCC1=CC(=NO1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)