CAS 148400-72-0 is the registry number for 2-tert-Butyldimethylsilyloxyethyl Tosylate. Offered by: TRC. Available pack sizes: 100mg.
2-[tert-butyl(dimethyl)silyl]oxyethyl 4-methylbenzenesulfonate (CAS 148400-72-0) is a chemical compound with the molecular formula C15H26O4SSi and a molecular weight of 330.5 g/mol. IUPAC name: 2-[tert-butyl(dimethyl)silyl]oxyethyl 4-methylbenzenesulfonate. InChIKey: SURVAMFPFPDSHK-UHFFFAOYSA-N.
| Molecular formula | C15H26O4SSi |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | 2-[tert-butyl(dimethyl)silyl]oxyethyl 4-methylbenzenesulfonate |
| InChIKey | SURVAMFPFPDSHK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)