Products 1484115-68-5
CAS 1484115-68-5 is the registry number for 1-Cyclopentyl-4,5,6,7-tetrahydro-1H-indazol-4-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-cyclopentyl-4,5,6,7-tetrahydroindazol-4-amine (CAS 1484115-68-5) is a chemical compound with the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. IUPAC name: 1-cyclopentyl-4,5,6,7-tetrahydroindazol-4-amine. InChIKey: MXPJYMNEWLWANM-UHFFFAOYSA-N.
| Molecular formula | C12H19N3 |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | 1-cyclopentyl-4,5,6,7-tetrahydroindazol-4-amine |
| InChIKey | MXPJYMNEWLWANM-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C3=C(C=N2)C(CCC3)N |
Computed by PubChem (NCBI)