Products 1484538-36-4
CAS 1484538-36-4 is the registry number for 1-(2,3-difluorophenyl)-4,4-dimethylcyclohexanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,3-difluorophenyl)-4,4-dimethylcyclohexan-1-ol (CAS 1484538-36-4) is a chemical compound with the molecular formula C14H18F2O and a molecular weight of 240.29 g/mol. IUPAC name: 1-(2,3-difluorophenyl)-4,4-dimethylcyclohexan-1-ol. InChIKey: YCICUXUSIHWPFX-UHFFFAOYSA-N.
| Molecular formula | C14H18F2O |
|---|---|
| Molecular weight | 240.29 g/mol |
| IUPAC name | 1-(2,3-difluorophenyl)-4,4-dimethylcyclohexan-1-ol |
| InChIKey | YCICUXUSIHWPFX-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)(C2=C(C(=CC=C2)F)F)O)C |
Computed by PubChem (NCBI)