Products 1484609-74-6

CAS 1484609-74-6 is the registry number for 2,4-Dimethylmorpholine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,4-dimethylmorpholine-3-carboxylic acid (CAS 1484609-74-6) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. IUPAC name: 2,4-dimethylmorpholine-3-carboxylic acid. InChIKey: BGXMTKGXWKKGPD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13NO3
Molecular weight159.18 g/mol
IUPAC name2,4-dimethylmorpholine-3-carboxylic acid
InChIKeyBGXMTKGXWKKGPD-UHFFFAOYSA-N
SMILESCC1C(N(CCO1)C)C(=O)O

Computed by PubChem (NCBI)