CAS 148461-12-5 appears in our catalog under these names: Oxazole, 2-[2-(diphenylphosphino)phenyl]-4,5-dihydro-4-methyl-, (4S)-, 95%, 95%, (4S)-2-[2-(Diphenylphosphino)phenyl]-4,5-dihydro-4-methyloxazole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
[2-[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane (CAS 148461-12-5) is a chemical compound with the molecular formula C22H20NOP and a molecular weight of 345.4 g/mol. IUPAC name: [2-[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane. InChIKey: LPALMDOOEDKULS-KRWDZBQOSA-N.
| Molecular formula | C22H20NOP |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | [2-[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane |
| InChIKey | LPALMDOOEDKULS-KRWDZBQOSA-N |
| SMILES | C[C@H]1COC(=N1)C2=CC=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)