CAS 148473-36-3 appears in our catalog under these names: JMV 390-1, JMV 390–1. Offered by: Creative Peptides, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 25mg, 10mg, 50mg, Get quote.
(2S)-2-[[(2S,3S)-2-[[(2R)-2-benzyl-4-(hydroxyamino)-4-oxobutanoyl]amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid (CAS 148473-36-3) is a chemical compound with the molecular formula C23H35N3O6 and a molecular weight of 449.5 g/mol. IUPAC name: (2S)-2-[[(2S,3S)-2-[[(2R)-2-benzyl-4-(hydroxyamino)-4-oxobutanoyl]amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid. InChIKey: MWZOULASPWUGJJ-NFBUACBFSA-N.
| Molecular formula | C23H35N3O6 |
|---|---|
| Molecular weight | 449.5 g/mol |
| IUPAC name | (2S)-2-[[(2S,3S)-2-[[(2R)-2-benzyl-4-(hydroxyamino)-4-oxobutanoyl]amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid |
| InChIKey | MWZOULASPWUGJJ-NFBUACBFSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)CC(=O)NO |
Computed by PubChem (NCBI)