CAS 148493-35-0 is the registry number for 2,6-Dichloro-3-(trimethylstannyl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg.
(2,6-dichloro-3-pyridinyl)-trimethylstannane (CAS 148493-35-0) is a chemical compound with the molecular formula C8H11Cl2NSn and a molecular weight of 310.79 g/mol. IUPAC name: (2,6-dichloro-3-pyridinyl)-trimethylstannane. InChIKey: DGDQQBNYGYNPTE-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2NSn |
|---|---|
| Molecular weight | 310.79 g/mol |
| IUPAC name | (2,6-dichloro-3-pyridinyl)-trimethylstannane |
| InChIKey | DGDQQBNYGYNPTE-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)C1=C(N=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)