Products 1485038-22-9
CAS 1485038-22-9 is the registry number for 2-(5-Fluoropyridin-3-yl)-5-methoxy-1,3-benzothiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5-fluoro-3-pyridinyl)-5-methoxy-1,3-benzothiazole (CAS 1485038-22-9) is a chemical compound with the molecular formula C13H9FN2OS and a molecular weight of 260.29 g/mol. IUPAC name: 2-(5-fluoro-3-pyridinyl)-5-methoxy-1,3-benzothiazole. InChIKey: GNICGMDJBIPMIE-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2OS |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 2-(5-fluoro-3-pyridinyl)-5-methoxy-1,3-benzothiazole |
| InChIKey | GNICGMDJBIPMIE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)SC(=N2)C3=CC(=CN=C3)F |
Computed by PubChem (NCBI)