Products 1485081-26-2
CAS 1485081-26-2 appears in our catalog under these names: Dolutegravir Impurity 10, N-De-2,4-difluorobenzyl Dolutegravir, Dolutegravir M1, Dolutegravir M1. Offered by: Hubei YoungXin, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 500ug.
(3S,7R)-11-hydroxy-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide (CAS 1485081-26-2) is a chemical compound with the molecular formula C13H15N3O5 and a molecular weight of 293.27 g/mol. IUPAC name: (3S,7R)-11-hydroxy-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide. InChIKey: IORBWJQXSCJOCL-SVRRBLITSA-N.
| Molecular formula | C13H15N3O5 |
|---|---|
| Molecular weight | 293.27 g/mol |
| IUPAC name | (3S,7R)-11-hydroxy-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
| InChIKey | IORBWJQXSCJOCL-SVRRBLITSA-N |
| SMILES | C[C@@H]1CCO[C@@H]2N1C(=O)C3=C(C(=O)C(=CN3C2)C(=O)N)O |
Computed by PubChem (NCBI)