CAS 1485415-27-7 appears in our catalog under these names: 2-Chloro-4-(5-phenyl-1H-1,2,4-triazol-3-yl)aniline, 95%, 2-Chloro-4-(5-phenyl-1H-1,2,4-triazol-3-yl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloro-4-(5-phenyl-1H-1,2,4-triazol-3-yl)aniline (CAS 1485415-27-7) is a chemical compound with the molecular formula C14H11ClN4 and a molecular weight of 270.72 g/mol. IUPAC name: 2-chloro-4-(5-phenyl-1H-1,2,4-triazol-3-yl)aniline. InChIKey: CWEARGYWCFVOIX-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN4 |
|---|---|
| Molecular weight | 270.72 g/mol |
| IUPAC name | 2-chloro-4-(5-phenyl-1H-1,2,4-triazol-3-yl)aniline |
| InChIKey | CWEARGYWCFVOIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NN2)C3=CC(=C(C=C3)N)Cl |
Computed by PubChem (NCBI)