CAS 1485425-65-7 appears in our catalog under these names: 1-Methyl-4-(4-methyl-2,5-dioxoimidazolidin-4-yl)pyridin-1-ium iodide, 95%, 1-Methyl-4-(4-methyl-2,5-dioxoimidazolidin-4-yl)pyridin-1-ium iodide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
5-methyl-5-(1-methylpyridin-1-ium-4-yl)imidazolidine-2,4-dione iodide (CAS 1485425-65-7) is a chemical compound with the molecular formula C10H12IN3O2 and a molecular weight of 333.13 g/mol. IUPAC name: 5-methyl-5-(1-methylpyridin-1-ium-4-yl)imidazolidine-2,4-dione iodide. InChIKey: LHBBIEQWDHIVMC-UHFFFAOYSA-N.
| Molecular formula | C10H12IN3O2 |
|---|---|
| Molecular weight | 333.13 g/mol |
| IUPAC name | 5-methyl-5-(1-methylpyridin-1-ium-4-yl)imidazolidine-2,4-dione iodide |
| InChIKey | LHBBIEQWDHIVMC-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CC=[N+](C=C2)C.[I-] |
Computed by PubChem (NCBI)