CAS 14856-91-8 is the registry number for Perfluoro-2-propanesulfonyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,1,1,2,3,3,3-heptafluoropropane-2-sulfonyl fluoride (CAS 14856-91-8) is a chemical compound with the molecular formula C3F8O2S and a molecular weight of 252.09 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonyl fluoride. InChIKey: YYBMGVRXEFBHTL-UHFFFAOYSA-N.
| Molecular formula | C3F8O2S |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonyl fluoride |
| InChIKey | YYBMGVRXEFBHTL-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(C(F)(F)F)(F)S(=O)(=O)F |
Computed by PubChem (NCBI)