Products 14856-91-8

CAS 14856-91-8 is the registry number for Perfluoro-2-propanesulfonyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1,1,1,2,3,3,3-heptafluoropropane-2-sulfonyl fluoride (CAS 14856-91-8) is a chemical compound with the molecular formula C3F8O2S and a molecular weight of 252.09 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonyl fluoride. InChIKey: YYBMGVRXEFBHTL-UHFFFAOYSA-N.

Identity
Molecular formulaC3F8O2S
Molecular weight252.09 g/mol
IUPAC name1,1,1,2,3,3,3-heptafluoropropane-2-sulfonyl fluoride
InChIKeyYYBMGVRXEFBHTL-UHFFFAOYSA-N
SMILESC(C(F)(F)F)(C(F)(F)F)(F)S(=O)(=O)F

Computed by PubChem (NCBI)