CAS 148561-76-6 appears in our catalog under these names: 3-{3-aminobicyclo(1.1.1)pentan-1-yl}bicyclo(1.1.1)pentan-1-amine, 97%, [1,1'-Bi(bicyclo[1.1.1]Pentane)]-3,3'-diamine, 98%, 98%, [1,1'-Bi(bicyclo[1.1.1]Pentane)]-3,3'-diamine, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg.
3-(3-amino-1-bicyclo[1.1.1]pentanyl)bicyclo[1.1.1]pentan-1-amine (CAS 148561-76-6) is a chemical compound with the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. IUPAC name: 3-(3-amino-1-bicyclo[1.1.1]pentanyl)bicyclo[1.1.1]pentan-1-amine. InChIKey: BPRDMFRAUPTIIM-UHFFFAOYSA-N.
| Molecular formula | C10H16N2 |
|---|---|
| Molecular weight | 164.25 g/mol |
| IUPAC name | 3-(3-amino-1-bicyclo[1.1.1]pentanyl)bicyclo[1.1.1]pentan-1-amine |
| InChIKey | BPRDMFRAUPTIIM-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)N)C34CC(C3)(C4)N |
Computed by PubChem (NCBI)