CAS 1485623-74-2 appears in our catalog under these names: (2S)-2-({2-Azabicyclo(2.2.1)heptane-2-carbonyl}amino)propanoic acid, (2S)-2-({2-azabicyclo(2.2.1)heptane-2-carbonyl}amino)propanoic acid, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g, 5g, 10g.
(2S)-2-(2-azabicyclo[2.2.1]heptane-2-carbonylamino)propanoic acid (CAS 1485623-74-2) is a chemical compound with the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. IUPAC name: (2S)-2-(2-azabicyclo[2.2.1]heptane-2-carbonylamino)propanoic acid. InChIKey: FVNPZBDWDWRABQ-KKMMWDRVSA-N.
| Molecular formula | C10H16N2O3 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | (2S)-2-(2-azabicyclo[2.2.1]heptane-2-carbonylamino)propanoic acid |
| InChIKey | FVNPZBDWDWRABQ-KKMMWDRVSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)N1CC2CCC1C2 |
Computed by PubChem (NCBI)