CAS 1486115-10-9 is the registry number for CRBN ligand-206. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-bromo-N-(2,6-dioxopiperidin-3-yl)pyridine-2-carboxamide (CAS 1486115-10-9) is a chemical compound with the molecular formula C11H10BrN3O3 and a molecular weight of 312.12 g/mol. IUPAC name: 5-bromo-N-(2,6-dioxopiperidin-3-yl)pyridine-2-carboxamide. InChIKey: YKZRGJZOEMDXQJ-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3O3 |
|---|---|
| Molecular weight | 312.12 g/mol |
| IUPAC name | 5-bromo-N-(2,6-dioxopiperidin-3-yl)pyridine-2-carboxamide |
| InChIKey | YKZRGJZOEMDXQJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1NC(=O)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)