Products 1486181-00-3

CAS 1486181-00-3 is the registry number for tert-Butyl 2-(aminomethyl)-3-methylbutanoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-(aminomethyl)-3-methylbutanoate (CAS 1486181-00-3) is a chemical compound with the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. IUPAC name: tert-butyl 2-(aminomethyl)-3-methylbutanoate. InChIKey: IEICEUUZDCPEOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H21NO2
Molecular weight187.28 g/mol
IUPAC nametert-butyl 2-(aminomethyl)-3-methylbutanoate
InChIKeyIEICEUUZDCPEOZ-UHFFFAOYSA-N
SMILESCC(C)C(CN)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)