Products 1486289-54-6

CAS 1486289-54-6 is the registry number for N-Ethyl-N-(2-methyl-2-propen-1-yl)-carbamic Acid 1,1-Dimethylethyl Ester. Offered by: TRC. Available pack sizes: 10g.

Structural formula: {0} (CAS {1})

Tert-butyl N-ethyl-N-(2-methylprop-2-enyl)carbamate (CAS 1486289-54-6) is a chemical compound with the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. IUPAC name: tert-butyl N-ethyl-N-(2-methylprop-2-enyl)carbamate. InChIKey: UDAXELVTKCYDJI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H21NO2
Molecular weight199.29 g/mol
IUPAC nametert-butyl N-ethyl-N-(2-methylprop-2-enyl)carbamate
InChIKeyUDAXELVTKCYDJI-UHFFFAOYSA-N
SMILESCCN(CC(=C)C)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)