Products 1486470-35-2
CAS 1486470-35-2 is the registry number for (1R,2R,3R,4S)-3-Aminobicyclo[2.2.1]heptane-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R,3R,4S)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid (CAS 1486470-35-2) is a chemical compound with the molecular formula C8H13NO2 and a molecular weight of 155.19 g/mol. IUPAC name: (1R,2R,3R,4S)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: JSYLGUSANAWARQ-XZBKPIIZSA-N.
| Molecular formula | C8H13NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | (1R,2R,3R,4S)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | JSYLGUSANAWARQ-XZBKPIIZSA-N |
| SMILES | C1C[C@H]2C[C@@H]1[C@H]([C@@H]2N)C(=O)O |
Computed by PubChem (NCBI)