CAS 1486473-03-3 is the registry number for rac-((1R,2S,4S)-7-Oxabicyclo(2.2.1)heptan-2-yl)methanamine, endo. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(1R,2S,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine (CAS 1486473-03-3) is a chemical compound with the molecular formula C7H13NO and a molecular weight of 127.18 g/mol. IUPAC name: [(1R,2S,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine. InChIKey: HOGOLKHCHFSFKN-LYFYHCNISA-N.
| Molecular formula | C7H13NO |
|---|---|
| Molecular weight | 127.18 g/mol |
| IUPAC name | [(1R,2S,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine |
| InChIKey | HOGOLKHCHFSFKN-LYFYHCNISA-N |
| SMILES | C1C[C@@H]2[C@@H](C[C@H]1O2)CN |
Computed by PubChem (NCBI)