CAS 1486510-12-6 is the registry number for Methyl (S)-2-amino-3-((tert-butoxycarbonyl)amino)-3-methylbutanoate oxalate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-amino-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;oxalic acid (CAS 1486510-12-6) is a chemical compound with the molecular formula C13H24N2O8 and a molecular weight of 336.34 g/mol. IUPAC name: methyl (2S)-2-amino-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;oxalic acid. InChIKey: WJZWRQJNPYWMSJ-OGFXRTJISA-N.
| Molecular formula | C13H24N2O8 |
|---|---|
| Molecular weight | 336.34 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;oxalic acid |
| InChIKey | WJZWRQJNPYWMSJ-OGFXRTJISA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)[C@@H](C(=O)OC)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)