CAS 1486563-21-6 is the registry number for (Anthracene-9,10-diylbis(4,1-phenylene))dimethanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-[10-[4-(aminomethyl)phenyl]anthracen-9-yl]phenyl]methanamine (CAS 1486563-21-6) is a chemical compound with the molecular formula C28H24N2 and a molecular weight of 388.5 g/mol. IUPAC name: [4-[10-[4-(aminomethyl)phenyl]anthracen-9-yl]phenyl]methanamine. InChIKey: FBRSHWUKPTXCSD-UHFFFAOYSA-N.
| Molecular formula | C28H24N2 |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | [4-[10-[4-(aminomethyl)phenyl]anthracen-9-yl]phenyl]methanamine |
| InChIKey | FBRSHWUKPTXCSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C4=CC=C(C=C4)CN)C5=CC=C(C=C5)CN |
Computed by PubChem (NCBI)