Products 148673-71-6

CAS 148673-71-6 is the registry number for 6-Chloropyrazine-2-carbonyl chloride 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

6-chloropyrazine-2-carbonyl chloride (CAS 148673-71-6) is a chemical compound with the molecular formula C5H2Cl2N2O and a molecular weight of 176.99 g/mol. IUPAC name: 6-chloropyrazine-2-carbonyl chloride. InChIKey: UHYKRNKLQNXGDA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2Cl2N2O
Molecular weight176.99 g/mol
IUPAC name6-chloropyrazine-2-carbonyl chloride
InChIKeyUHYKRNKLQNXGDA-UHFFFAOYSA-N
SMILESC1=C(N=C(C=N1)Cl)C(=O)Cl

Computed by PubChem (NCBI)