Products 148706-06-3
CAS 148706-06-3 appears in our catalog under these names: 4–hydroxy Nonenal–d3, 4-Hydroxynonenal-d3, 99.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 100μg, 50μg, 500μg, 50 μg (3.14 mM * 100 μL in Methyl acetate).
(E)-9,9,9-trideuterio-4-hydroxynon-2-enal (CAS 148706-06-3) is a chemical compound with the molecular formula C9H16O2 and a molecular weight of 159.24 g/mol. IUPAC name: (E)-9,9,9-trideuterio-4-hydroxynon-2-enal. InChIKey: JVJFIQYAHPMBBX-PKJLGKQPSA-N.
| Molecular formula | C9H16O2 |
|---|---|
| Molecular weight | 159.24 g/mol |
| IUPAC name | (E)-9,9,9-trideuterio-4-hydroxynon-2-enal |
| InChIKey | JVJFIQYAHPMBBX-PKJLGKQPSA-N |
| SMILES | [2H]C([2H])([2H])CCCCC(/C=C/C=O)O |
Computed by PubChem (NCBI)