CAS 148706-30-3 appears in our catalog under these names: 4–Methoxy–2–methylphenylmagnesium bromide, 4-METHOXY-2-METHYLPHENYLMAGNESIUM BROMI&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 100ml, 50ML.
Magnesium;1-methoxy-3-methylbenzene-4-ide;bromide (CAS 148706-30-3) is a chemical compound with the molecular formula C8H9BrMgO and a molecular weight of 225.37 g/mol. IUPAC name: magnesium;1-methoxy-3-methylbenzene-4-ide;bromide. InChIKey: RXSNLPFCJCJYQB-UHFFFAOYSA-M.
| Molecular formula | C8H9BrMgO |
|---|---|
| Molecular weight | 225.37 g/mol |
| IUPAC name | magnesium;1-methoxy-3-methylbenzene-4-ide;bromide |
| InChIKey | RXSNLPFCJCJYQB-UHFFFAOYSA-M |
| SMILES | CC1=[C-]C=CC(=C1)OC.[Mg+2].[Br-] |
Computed by PubChem (NCBI)