CAS 148719-91-9 appears in our catalog under these names: Dorzolamide Impurity 41, (S)-6-Methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-one 7,7-dioxide 95%, (6S)-5,6-Dihydro-6-methyl-4H-thieno[2,3-b]thiopyran-4-one 7,7-dioxide, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 1g, 5g, 250mg, 500mg.
(6S)-6-methyl-7,7-dioxo-5,6-dihydrothieno[2,3-b]thiopyran-4-one (CAS 148719-91-9) is a chemical compound with the molecular formula C8H8O3S2 and a molecular weight of 216.3 g/mol. IUPAC name: (6S)-6-methyl-7,7-dioxo-5,6-dihydrothieno[2,3-b]thiopyran-4-one. InChIKey: LQUUXMUPBQBKHA-YFKPBYRVSA-N.
| Molecular formula | C8H8O3S2 |
|---|---|
| Molecular weight | 216.3 g/mol |
| IUPAC name | (6S)-6-methyl-7,7-dioxo-5,6-dihydrothieno[2,3-b]thiopyran-4-one |
| InChIKey | LQUUXMUPBQBKHA-YFKPBYRVSA-N |
| SMILES | C[C@H]1CC(=O)C2=C(S1(=O)=O)SC=C2 |
Computed by PubChem (NCBI)