CAS 148736-30-5 is the registry number for N-(4-Azidobutyl)-1,3-propanediamine Dihydrochloride Salt. Offered by: TRC. Available pack sizes: 2,5g.
N'-(4-azidobutyl)propane-1,3-diamine;dihydrochloride (CAS 148736-30-5) is a chemical compound with the molecular formula C7H19Cl2N5 and a molecular weight of 244.16 g/mol. IUPAC name: N'-(4-azidobutyl)propane-1,3-diamine;dihydrochloride. InChIKey: FKZYJDHYUPQUGV-UHFFFAOYSA-N.
| Molecular formula | C7H19Cl2N5 |
|---|---|
| Molecular weight | 244.16 g/mol |
| IUPAC name | N'-(4-azidobutyl)propane-1,3-diamine;dihydrochloride |
| InChIKey | FKZYJDHYUPQUGV-UHFFFAOYSA-N |
| SMILES | C(CCN=[N+]=[N-])CNCCCN.Cl.Cl |
Computed by PubChem (NCBI)