Products 1487380-39-1
CAS 1487380-39-1 is the registry number for (2S,3S)-2-Azido-3-methylpentanoic acid cyclohexanamine salt. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g.
(2S,3S)-2-azido-3-methylpentanoic acid;cyclohexanamine (CAS 1487380-39-1) is a chemical compound with the molecular formula C12H24N4O2 and a molecular weight of 256.34 g/mol. IUPAC name: (2S,3S)-2-azido-3-methylpentanoic acid;cyclohexanamine. InChIKey: GQGCYTXUHJDTIC-FHAQVOQBSA-N.
| Molecular formula | C12H24N4O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | (2S,3S)-2-azido-3-methylpentanoic acid;cyclohexanamine |
| InChIKey | GQGCYTXUHJDTIC-FHAQVOQBSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)N=[N+]=[N-].C1CCC(CC1)N |
Computed by PubChem (NCBI)