CAS 14875-96-8 appears in our catalog under these names: Fe(II) Protoporphyrin IX (Hematin), Ferroprotoporphyrin IX, Ferroprotoporphyrin, Ferroheme/ 97.63% (existing batch purity), HEME. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 250mg, 1mg, 2mg.
3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoic acid;iron(2+) (CAS 14875-96-8) is a chemical compound with the molecular formula C34H32FeN4O4 and a molecular weight of 616.5 g/mol. IUPAC name: 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoic acid;iron(2+). InChIKey: KABFMIBPWCXCRK-UHFFFAOYSA-L.
| Molecular formula | C34H32FeN4O4 |
|---|---|
| Molecular weight | 616.5 g/mol |
| IUPAC name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoic acid;iron(2+) |
| InChIKey | KABFMIBPWCXCRK-UHFFFAOYSA-L |
| SMILES | CC1=C(C2=CC3=C(C(=C([N-]3)C=C4C(=C(C(=N4)C=C5C(=C(C(=N5)C=C1[N-]2)C)C=C)C)C=C)C)CCC(=O)O)CCC(=O)O.[Fe+2] |
Computed by PubChem (NCBI)