Products 148796-53-6
CAS 148796-53-6 appears in our catalog under these names: α-hydroxy Farnesyl Phosphonic Acid, α–hydroxy Farnesyl Phosphonic Acid, alpha-Hydroxy farnesyl phosphonic acid. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 10 mg, 5 mg.
[(1S,3R,7R)-1-hydroxy-3,7,11-trimethyldodecyl]phosphonic acid (CAS 148796-53-6) is a chemical compound with the molecular formula C15H33O4P and a molecular weight of 308.39 g/mol. IUPAC name: [(1S,3R,7R)-1-hydroxy-3,7,11-trimethyldodecyl]phosphonic acid. InChIKey: IJNCEETVCWDDQB-KFWWJZLASA-N.
| Molecular formula | C15H33O4P |
|---|---|
| Molecular weight | 308.39 g/mol |
| IUPAC name | [(1S,3R,7R)-1-hydroxy-3,7,11-trimethyldodecyl]phosphonic acid |
| InChIKey | IJNCEETVCWDDQB-KFWWJZLASA-N |
| SMILES | C[C@@H](CCC[C@@H](C)C[C@@H](O)P(=O)(O)O)CCCC(C)C |
Computed by PubChem (NCBI)