Products 1488090-21-6

CAS 1488090-21-6 is the registry number for BCR-ABL1-IN-1, 99.82%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 100 mg, 10 mg, 25 mg, 5 mg, 10mM/1mL.

Structural formula: {0} (CAS {1})

5-pyridin-3-yl-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide (CAS 1488090-21-6) is a chemical compound with the molecular formula C18H12F3N3O2 and a molecular weight of 359.3 g/mol. IUPAC name: 5-pyridin-3-yl-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide. InChIKey: VGZOEYFNUDMUIX-UHFFFAOYSA-N.

Identity
Molecular formulaC18H12F3N3O2
Molecular weight359.3 g/mol
IUPAC name5-pyridin-3-yl-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide
InChIKeyVGZOEYFNUDMUIX-UHFFFAOYSA-N
SMILESC1=CC(=CN=C1)C2=CC(=CN=C2)C(=O)NC3=CC=C(C=C3)OC(F)(F)F

Computed by PubChem (NCBI)