CAS 1488090-21-6 is the registry number for BCR-ABL1-IN-1, 99.82%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 100 mg, 10 mg, 25 mg, 5 mg, 10mM/1mL.
5-pyridin-3-yl-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide (CAS 1488090-21-6) is a chemical compound with the molecular formula C18H12F3N3O2 and a molecular weight of 359.3 g/mol. IUPAC name: 5-pyridin-3-yl-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide. InChIKey: VGZOEYFNUDMUIX-UHFFFAOYSA-N.
| Molecular formula | C18H12F3N3O2 |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | 5-pyridin-3-yl-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
| InChIKey | VGZOEYFNUDMUIX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC(=CN=C2)C(=O)NC3=CC=C(C=C3)OC(F)(F)F |
Computed by PubChem (NCBI)