CAS 148810-36-0 appears in our catalog under these names: Tricyclo(5.2.1.0,2,6)decane-2-carboxylic acid, 95%, Tricyclo(5.2.1.0,2,6)decane-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tricyclo[5.2.1.02,6]decane-2-carboxylic acid (CAS 148810-36-0) is a chemical compound with the molecular formula C11H16O2 and a molecular weight of 180.24 g/mol. IUPAC name: tricyclo[5.2.1.02,6]decane-2-carboxylic acid. InChIKey: BPPVMMLQNBPNBD-UHFFFAOYSA-N.
| Molecular formula | C11H16O2 |
|---|---|
| Molecular weight | 180.24 g/mol |
| IUPAC name | tricyclo[5.2.1.02,6]decane-2-carboxylic acid |
| InChIKey | BPPVMMLQNBPNBD-UHFFFAOYSA-N |
| SMILES | C1CC2C3CCC(C3)C2(C1)C(=O)O |
Computed by PubChem (NCBI)