CAS 1488326-20-0 is the registry number for (S)-Isopropyl 2-((tert-butoxycarbonyl)amino)-3-iodopropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl (2S)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 1488326-20-0) is a chemical compound with the molecular formula C11H20INO4 and a molecular weight of 357.19 g/mol. IUPAC name: propan-2-yl (2S)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: FNUJLZTYHFPLCX-MRVPVSSYSA-N.
| Molecular formula | C11H20INO4 |
|---|---|
| Molecular weight | 357.19 g/mol |
| IUPAC name | propan-2-yl (2S)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | FNUJLZTYHFPLCX-MRVPVSSYSA-N |
| SMILES | CC(C)OC(=O)[C@@H](CI)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)