CAS 1488351-25-2 appears in our catalog under these names: Alternariol 9-Methyl Ether 3-Sulfate Ammonium Salt, >95% (HPLC), AME-3-sulfate ammonium salt. Offered by: TRC, HPC Standards. Available pack sizes: 10mg, 1mg, 50mg, 1x5mg.
Azane;(7-hydroxy-9-methoxy-1-methyl-6-oxobenzo[c]chromen-3-yl) hydrogen sulfate (CAS 1488351-25-2) is a chemical compound with the molecular formula C15H15NO8S and a molecular weight of 369.3 g/mol. IUPAC name: azane;(7-hydroxy-9-methoxy-1-methyl-6-oxobenzo[c]chromen-3-yl) hydrogen sulfate. InChIKey: FIGMXDRZMRFHRS-UHFFFAOYSA-N.
| Molecular formula | C15H15NO8S |
|---|---|
| Molecular weight | 369.3 g/mol |
| IUPAC name | azane;(7-hydroxy-9-methoxy-1-methyl-6-oxobenzo[c]chromen-3-yl) hydrogen sulfate |
| InChIKey | FIGMXDRZMRFHRS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1C3=C(C(=CC(=C3)OC)O)C(=O)O2)OS(=O)(=O)O.N |
Computed by PubChem (NCBI)