CAS 1488351-27-4 appears in our catalog under these names: Alternariol 3-Sulfate Ammonium Salt, Alternariol-3-sulfate ammonium salt. Offered by: TRC, HPC Standards. Available pack sizes: 50mg, 1x5mg.
Azane;(7,9-dihydroxy-1-methyl-6-oxobenzo[c]chromen-3-yl) hydrogen sulfate (CAS 1488351-27-4) is a chemical compound with the molecular formula C14H13NO8S and a molecular weight of 355.32 g/mol. IUPAC name: azane;(7,9-dihydroxy-1-methyl-6-oxobenzo[c]chromen-3-yl) hydrogen sulfate. InChIKey: NWDZSGIYZZFVBS-UHFFFAOYSA-N.
| Molecular formula | C14H13NO8S |
|---|---|
| Molecular weight | 355.32 g/mol |
| IUPAC name | azane;(7,9-dihydroxy-1-methyl-6-oxobenzo[c]chromen-3-yl) hydrogen sulfate |
| InChIKey | NWDZSGIYZZFVBS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1C3=C(C(=CC(=C3)O)O)C(=O)O2)OS(=O)(=O)O.N |
Computed by PubChem (NCBI)