CAS 1488363-78-5 appears in our catalog under these names: Adomeglivant (LY2409021), Adomeglivant, Adomeglivant/ 99.97% (existing batch purity), Adomeglivant 98%, Adomeglivant, 98%, 98%. Offered by: GLPBio, TRC, TargetMol, Ambeed, Chemat. Available pack sizes: 5mg, 250mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg.
3-[[4-[(1S)-1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]benzoyl]amino]propanoic acid (CAS 1488363-78-5) is a chemical compound with the molecular formula C32H36F3NO4 and a molecular weight of 555.6 g/mol. IUPAC name: 3-[[4-[(1S)-1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]benzoyl]amino]propanoic acid. InChIKey: FASLTMSUPQDLIB-MHZLTWQESA-N.
| Molecular formula | C32H36F3NO4 |
|---|---|
| Molecular weight | 555.6 g/mol |
| IUPAC name | 3-[[4-[(1S)-1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]benzoyl]amino]propanoic acid |
| InChIKey | FASLTMSUPQDLIB-MHZLTWQESA-N |
| SMILES | CC1=CC(=CC(=C1C2=CC=C(C=C2)C(C)(C)C)C)O[C@@H](CCC(F)(F)F)C3=CC=C(C=C3)C(=O)NCCC(=O)O |
Computed by PubChem (NCBI)