CAS 1488424-86-7 is the registry number for 3-(6-Methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzaldehyde, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
3-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzaldehyde (CAS 1488424-86-7) is a chemical compound with the molecular formula C12H12BNO5 and a molecular weight of 261.04 g/mol. IUPAC name: 3-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzaldehyde. InChIKey: XEUKQFIKPZSUTP-UHFFFAOYSA-N.
| Molecular formula | C12H12BNO5 |
|---|---|
| Molecular weight | 261.04 g/mol |
| IUPAC name | 3-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzaldehyde |
| InChIKey | XEUKQFIKPZSUTP-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC(=CC=C2)C=O |
Computed by PubChem (NCBI)