CAS 148901-52-4 is the registry number for 2-Fluoro-6-[4-(methylthio)phenoxy]benzonitrile. Offered by: Fluorochem. Available pack sizes: 1g.
2-fluoro-6-(4-methylsulfanylphenoxy)benzonitrile (CAS 148901-52-4) is a chemical compound with the molecular formula C14H10FNOS and a molecular weight of 259.30 g/mol. IUPAC name: 2-fluoro-6-(4-methylsulfanylphenoxy)benzonitrile. InChIKey: KIJMTRJIUKHLPE-UHFFFAOYSA-N.
| Molecular formula | C14H10FNOS |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 2-fluoro-6-(4-methylsulfanylphenoxy)benzonitrile |
| InChIKey | KIJMTRJIUKHLPE-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)OC2=C(C(=CC=C2)F)C#N |
Computed by PubChem (NCBI)