CAS 1489127-72-1 appears in our catalog under these names: 6-(Pyrazin-2-ylsulfanyl)pyridine-2-carbonitrile, 98%, 6-(Pyrazin-2-ylsulfanyl)pyridine-2-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-pyrazin-2-ylsulfanylpyridine-2-carbonitrile (CAS 1489127-72-1) is a chemical compound with the molecular formula C10H6N4S and a molecular weight of 214.25 g/mol. IUPAC name: 6-pyrazin-2-ylsulfanylpyridine-2-carbonitrile. InChIKey: QERSAHRCGCWUKU-UHFFFAOYSA-N.
| Molecular formula | C10H6N4S |
|---|---|
| Molecular weight | 214.25 g/mol |
| IUPAC name | 6-pyrazin-2-ylsulfanylpyridine-2-carbonitrile |
| InChIKey | QERSAHRCGCWUKU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)SC2=NC=CN=C2)C#N |
Computed by PubChem (NCBI)