CAS 1489259-11-1 is the registry number for (2,2',3,3',4',5,5',6,6'-d9-(1,1'-Biphenyl)-4-yl)boronic Acid. Offered by: TRC. Available pack sizes: 500mg.
[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]boronic acid (CAS 1489259-11-1) is a chemical compound with the molecular formula C12H11BO2 and a molecular weight of 207.08 g/mol. IUPAC name: [2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]boronic acid. InChIKey: XPEIJWZLPWNNOK-LOIXRAQWSA-N.
| Molecular formula | C12H11BO2 |
|---|---|
| Molecular weight | 207.08 g/mol |
| IUPAC name | [2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]boronic acid |
| InChIKey | XPEIJWZLPWNNOK-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])B(O)O)[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)